C20H24BrN9O4 — CID 176621643
[(3S,4S)-3-[4-bromo-2-(2-methyl-1,3-dihydrotetrazol-5-yl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 176621643) has the molecular formula C20H24BrN9O4 and a molecular weight of 534.38 g/mol. Its IUPAC name is [(3S,4S)-3-[4-bromo-2-(2-methyl-1,3-dihydrotetrazol-5-yl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3S,4S)-3-[4-bromo-2-(2-methyl-1,3-dihydrotetrazol-5-yl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 176621643 |
| Molecular Formula | C20H24BrN9O4 |
| Molecular Weight | 534.38 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | [(3S,4S)-3-[4-bromo-2-(2-methyl-1,3-dihydrotetrazol-5-yl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2C[C@H](Nc3c(C4=NNN(C)N4)cc(Br)cc3[N+](=O)[O-])[C@@H](OC)C2)c1 |
| InChI | InChI=1S/C20H24BrN9O4/c1-22-13-4-11(7-23-8-13)20(31)29-9-15(17(10-29)34-3)24-18-14(19-25-27-28(2)26-19)5-12(21)6-16(18)30(32)33/h4-8,15,17,22,24,27H,9-10H2,1-3H3,(H,25,26)/t15-,17-/m0/s1 |
| InChIKey | NGRAKLPVVWHZHU-RDJZCZTQSA-N |
| XLogP | 1.36 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|