C50H95NO4 — CID 176714250
7-[6-(2-hexyldecanoyloxy)hexyl-pent-4-ynylamino]heptyl 2-hexyldecanoate (PubChem CID 176714250) has the molecular formula C50H95NO4 and a molecular weight of 774.31 g/mol. Its IUPAC name is 7-[6-(2-hexyldecanoyloxy)hexyl-pent-4-ynylamino]heptyl 2-hexyldecanoate.
| Compound Name | 7-[6-(2-hexyldecanoyloxy)hexyl-pent-4-ynylamino]heptyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 176714250 |
| Molecular Formula | C50H95NO4 |
| Molecular Weight | 774.31 g/mol |
| Exact Mass | 773.73 |
| IUPAC Name | 7-[6-(2-hexyldecanoyloxy)hexyl-pent-4-ynylamino]heptyl 2-hexyldecanoate |
| SMILES | C#CCCCN(CCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H95NO4/c1-6-11-16-20-23-31-40-47(38-29-18-13-8-3)49(52)54-45-36-27-22-25-34-43-51(42-33-15-10-5)44-35-26-28-37-46-55-50(53)48(39-30-19-14-9-4)41-32-24-21-17-12-7-2/h5,47-48H,6-9,11-46H2,1-4H3 |
| InChIKey | MQHXTRVSHJFSGG-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.31 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|