C52H101NO4 — CID 177320265
6-[hept-4-ynyl-[6-(2-hexyldecanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate;methane (PubChem CID 177320265) has the molecular formula C52H101NO4 and a molecular weight of 804.38 g/mol. Its IUPAC name is 6-[hept-4-ynyl-[6-(2-hexyldecanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate;methane.
| Compound Name | 6-[hept-4-ynyl-[6-(2-hexyldecanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate;methane |
|---|---|
| PubChem CID | 177320265 |
| Molecular Formula | C52H101NO4 |
| Molecular Weight | 804.38 g/mol |
| Exact Mass | 803.77 |
| IUPAC Name | 6-[hept-4-ynyl-[6-(2-hexyldecanoyloxy)hexyl]amino]hexyl 2-hexyldecanoate;methane |
| SMILES | C.CCC#CCCCN(CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H97NO4.CH4/c1-6-11-16-21-23-32-41-48(39-30-19-14-9-4)50(53)55-46-37-28-26-35-44-52(43-34-25-18-13-8-3)45-36-27-29-38-47-56-51(54)49(40-31-20-15-10-5)42-33-24-22-17-12-7-2;/h48-49H,6-12,14-17,19-47H2,1-5H3;1H4 |
| InChIKey | OVOQUXSCQMRKAT-UHFFFAOYSA-N |
| XLogP | 16.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.38 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|