C8H5N2O2+ — CID 176723883
5-nitro-1,2-dihydroindol-2-ylium (PubChem CID 176723883) has the molecular formula C8H5N2O2+ and a molecular weight of 161.14 g/mol. Its IUPAC name is 5-nitro-1,2-dihydroindol-2-ylium.
| Compound Name | 5-nitro-1,2-dihydroindol-2-ylium |
|---|---|
| PubChem CID | 176723883 |
| Molecular Formula | C8H5N2O2+ |
| Molecular Weight | 161.14 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 5-nitro-1,2-dihydroindol-2-ylium |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C=[C+]N2 |
| InChI | InChI=1S/C8H5N2O2/c11-10(12)7-1-2-8-6(5-7)3-4-9-8/h1-3,5,9H/q+1 |
| InChIKey | BXNJVPRFJWRFOA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|