C14H14N4O6S2 — CID 158936662
2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;5-nitro-1,3-dihydro-2,1-benzothiazole 2,2-dioxide (PubChem CID 158936662) has the molecular formula C14H14N4O6S2 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;5-nitro-1,3-dihydro-2,1-benzothiazole 2,2-dioxide.
| Compound Name | 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;5-nitro-1,3-dihydro-2,1-benzothiazole 2,2-dioxide |
|---|---|
| PubChem CID | 158936662 |
| Molecular Formula | C14H14N4O6S2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine;5-nitro-1,3-dihydro-2,1-benzothiazole 2,2-dioxide |
| SMILES | Nc1ccc2c(c1)CS(=O)(=O)N2.O=[N+]([O-])c1ccc2c(c1)CS(=O)(=O)N2 |
| InChI | InChI=1S/C7H6N2O4S.C7H8N2O2S/c10-9(11)6-1-2-7-5(3-6)4-14(12,13)8-7;8-6-1-2-7-5(3-6)4-12(10,11)9-7/h1-3,8H,4H2;1-3,9H,4,8H2 |
| InChIKey | JJSRVZNKVAYTGH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|