C45H62O4 — CID 177224702
[2-[2-(cyclohexen-1-yl)-5-methylcyclohexyl]oxy-2-oxo-1,1-diphenylethyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 177224702) has the molecular formula C45H62O4 and a molecular weight of 666.99 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)-5-methylcyclohexyl]oxy-2-oxo-1,1-diphenylethyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)-5-methylcyclohexyl]oxy-2-oxo-1,1-diphenylethyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 177224702 |
| Molecular Formula | C45H62O4 |
| Molecular Weight | 666.99 g/mol |
| Exact Mass | 666.46 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)-5-methylcyclohexyl]oxy-2-oxo-1,1-diphenylethyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(C(=O)OC1CC(C)CCC1C1=CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H62O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-26-33-43(46)49-45(39-29-22-18-23-30-39,40-31-24-19-25-32-40)44(47)48-42-36-37(2)34-35-41(42)38-27-20-17-21-28-38/h7-8,10-11,18-19,22-25,27,29-32,37,41-42H,3-6,9,12-17,20-21,26,28,33-36H2,1-2H3/b8-7-,11-10- |
| InChIKey | YEWHSTFVKNWZKP-NQLNTKRDSA-N |
| XLogP | 12.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.99 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|