C22H36O4 — CID 177466445
(1R,2R,5R,6S)-1-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol (PubChem CID 177466445) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (1R,2R,5R,6S)-1-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol.
| Compound Name | (1R,2R,5R,6S)-1-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
|---|---|
| PubChem CID | 177466445 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (1R,2R,5R,6S)-1-[(2E,6E)-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
| SMILES | CC1=C[C@@H](O)[C@@]2(C/C=C(\C)CC/C=C(\C)CCCC(C)(C)O)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C22H36O4/c1-15(10-7-12-21(4,5)25)8-6-9-16(2)11-13-22-18(23)14-17(3)19(24)20(22)26-22/h8,11,14,18-20,23-25H,6-7,9-10,12-13H2,1-5H3/b15-8+,16-11+/t18-,19-,20+,22-/m1/s1 |
| InChIKey | GWVCFDCDFFGRDG-GIHWCJQHSA-N |
| XLogP | 3.81 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|