C16H18N2 — CID 177496995
(E)-2-N,2-N-diphenylbut-1-ene-1,2-diamine (PubChem CID 177496995) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (E)-2-N,2-N-diphenylbut-1-ene-1,2-diamine.
| Compound Name | (E)-2-N,2-N-diphenylbut-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 177496995 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (E)-2-N,2-N-diphenylbut-1-ene-1,2-diamine |
| SMILES | CC/C(=C\N)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2/c1-2-14(13-17)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13H,2,17H2,1H3/b14-13+ |
| InChIKey | COFGHKCRUQZJNO-BUHFOSPRSA-N |
| XLogP | 4.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |