C25H37NO2 — CID 178046305
(2E,4E)-6-[(4E,7aR)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-N-hydroxy-4-methylhexa-2,4-dienamide (PubChem CID 178046305) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (2E,4E)-6-[(4E,7aR)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-N-hydroxy-4-methylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-6-[(4E,7aR)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-N-hydroxy-4-methylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 178046305 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (2E,4E)-6-[(4E,7aR)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-N-hydroxy-4-methylhexa-2,4-dienamide |
| SMILES | CC(/C=C/C(=O)NO)=C\CC1CCC2/C(=C/C=C3CCCCC3)CCC[C@]12C |
| InChI | InChI=1S/C25H37NO2/c1-19(11-17-24(27)26-28)10-14-22-15-16-23-21(9-6-18-25(22,23)2)13-12-20-7-4-3-5-8-20/h10-13,17,22-23,28H,3-9,14-16,18H2,1-2H3,(H,26,27)/b17-11+,19-10+,21-13+/t22?,23?,25-/m1/s1 |
| InChIKey | QUBOIOCVOCRJFF-OLOMETJVSA-N |
| XLogP | 6.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|