C24H27ClN3O3+ — CID 178150024
4-[1-(4-chlorophenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-N-methylbenzamide (PubChem CID 178150024) has the molecular formula C24H27ClN3O3+ and a molecular weight of 440.95 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-N-methylbenzamide.
| Compound Name | 4-[1-(4-chlorophenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 178150024 |
| Molecular Formula | C24H27ClN3O3+ |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-N-methylbenzamide |
| SMILES | C=CC(=O)[N+]1=C(C)CN(CC(Oc2ccc(C(=O)NC)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-4-23(29)28-14-13-27(15-17(28)2)16-22(18-5-9-20(25)10-6-18)31-21-11-7-19(8-12-21)24(30)26-3/h4-12,22H,1,13-16H2,2-3H3/p+1 |
| InChIKey | YXASDSJPRXZWRH-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|