C36H38N6O12S2 — CID 18366726
2-[3,5-diamino-7-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)heptyl]-6-methylpyrrolo[3,4-c]carbazole-1,3-dione;methanesulfonic acid (PubChem CID 18366726) has the molecular formula C36H38N6O12S2 and a molecular weight of 810.86 g/mol. Its IUPAC name is 2-[3,5-diamino-7-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)heptyl]-6-methylpyrrolo[3,4-c]carbazole-1,3-dione;methanesulfonic acid.
| Compound Name | 2-[3,5-diamino-7-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)heptyl]-6-methylpyrrolo[3,4-c]carbazole-1,3-dione;methanesulfonic acid |
|---|---|
| PubChem CID | 18366726 |
| Molecular Formula | C36H38N6O12S2 |
| Molecular Weight | 810.86 g/mol |
| Exact Mass | 810.20 |
| IUPAC Name | 2-[3,5-diamino-7-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)heptyl]-6-methylpyrrolo[3,4-c]carbazole-1,3-dione;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.Cn1c2ccccc2c2c3c(ccc21)C(=O)N(CCC(N)CC(N)CCN1C(=O)c2cccc4cc([N+](=O)[O-])cc(c24)C1=O)C3=O |
| InChI | InChI=1S/C34H30N6O6.2CH4O3S/c1-37-26-8-3-2-6-22(26)29-27(37)10-9-24-30(29)34(44)39(32(24)42)14-12-20(36)16-19(35)11-13-38-31(41)23-7-4-5-18-15-21(40(45)46)17-25(28(18)23)33(38)43;2*1-5(2,3)4/h2-10,15,17,19-20H,11-14,16,35-36H2,1H3;2*1H3,(H,2,3,4) |
| InChIKey | NNTZLWJMBUWZFK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 283.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.86 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|