C32H41NO2Si — CID 18682918
4-[tert-butyl(diphenyl)silyl]oxy-1-[(7R)-7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one (PubChem CID 18682918) has the molecular formula C32H41NO2Si and a molecular weight of 499.77 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-1-[(7R)-7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-[(7R)-7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one |
|---|---|
| PubChem CID | 18682918 |
| Molecular Formula | C32H41NO2Si |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-[(7R)-7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one |
| SMILES | CN(C)[C@@H]1CCc2cccc(C(=O)CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2C1 |
| InChI | InChI=1S/C32H41NO2Si/c1-32(2,3)36(27-15-8-6-9-16-27,28-17-10-7-11-18-28)35-23-13-20-31(34)29-19-12-14-25-21-22-26(33(4)5)24-30(25)29/h6-12,14-19,26H,13,20-24H2,1-5H3/t26-/m1/s1 |
| InChIKey | PTXXWMQMCOXSIR-AREMUKBSSA-N |
| XLogP | 5.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|