C12H13N5O5S2 — CID 19581881
(4-nitro-1H-pyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 19581881) has the molecular formula C12H13N5O5S2 and a molecular weight of 371.40 g/mol. Its IUPAC name is (4-nitro-1H-pyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (4-nitro-1H-pyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 19581881 |
| Molecular Formula | C12H13N5O5S2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (4-nitro-1H-pyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1[nH]ncc1[N+](=O)[O-])N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C12H13N5O5S2/c18-12(11-9(17(19)20)8-13-14-11)15-3-5-16(6-4-15)24(21,22)10-2-1-7-23-10/h1-2,7-8H,3-6H2,(H,13,14) |
| InChIKey | UXBBZTALRBWKBI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|