C25H34F2N2O4 — CID 19934084
3-(2,4-difluorophenyl)-1-[2,2-dimethoxyethoxy(phenyl)methyl]-1-heptylurea (PubChem CID 19934084) has the molecular formula C25H34F2N2O4 and a molecular weight of 464.55 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-[2,2-dimethoxyethoxy(phenyl)methyl]-1-heptylurea.
| Compound Name | 3-(2,4-difluorophenyl)-1-[2,2-dimethoxyethoxy(phenyl)methyl]-1-heptylurea |
|---|---|
| PubChem CID | 19934084 |
| Molecular Formula | C25H34F2N2O4 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-[2,2-dimethoxyethoxy(phenyl)methyl]-1-heptylurea |
| SMILES | CCCCCCCN(C(=O)Nc1ccc(F)cc1F)C(OCC(OC)OC)c1ccccc1 |
| InChI | InChI=1S/C25H34F2N2O4/c1-4-5-6-7-11-16-29(25(30)28-22-15-14-20(26)17-21(22)27)24(19-12-9-8-10-13-19)33-18-23(31-2)32-3/h8-10,12-15,17,23-24H,4-7,11,16,18H2,1-3H3,(H,28,30) |
| InChIKey | OFQVENMAWOGWAU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|