About Naphthalen-2-yl-boron
Naphthalen-2-yl-boron (PubChem CID 20596918) has the molecular formula C10H7B
and a molecular weight of 137.98 g/mol.
Molecular Properties
| Compound Name | Naphthalen-2-yl-boron |
| PubChem CID | 20596918 |
| Molecular Formula | C10H7B |
| Molecular Weight | 137.98 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H7B/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | GCWSSSZTLAHTRB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.98 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Naphthalen-2-yl-boron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Naphthalen-2-yl-boron?
The IUPAC name of Naphthalen-2-yl-boron (CID 20596918) is not available.
What is the SMILES notation for Naphthalen-2-yl-boron?
The canonical SMILES for Naphthalen-2-yl-boron is [B]c1ccc2ccccc2c1.
What is the InChIKey of Naphthalen-2-yl-boron?
The InChIKey is GCWSSSZTLAHTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7B/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H.
What are the key properties of Naphthalen-2-yl-boron?
Naphthalen-2-yl-boron has a molecular weight of 137.98 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Naphthalen-2-yl-boron is sourced from PubChem (CID 20596918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).