C16H24F2O2 — CID 20599750
2-[(E)-but-1-enyl]-5-[4-(2,2-difluoroethenyl)cyclohexyl]-1,3-dioxane (PubChem CID 20599750) has the molecular formula C16H24F2O2 and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[(E)-but-1-enyl]-5-[4-(2,2-difluoroethenyl)cyclohexyl]-1,3-dioxane.
| Compound Name | 2-[(E)-but-1-enyl]-5-[4-(2,2-difluoroethenyl)cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599750 |
| Molecular Formula | C16H24F2O2 |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-[(E)-but-1-enyl]-5-[4-(2,2-difluoroethenyl)cyclohexyl]-1,3-dioxane |
| SMILES | CC/C=C/C1OCC(C2CCC(C=C(F)F)CC2)CO1 |
| InChI | InChI=1S/C16H24F2O2/c1-2-3-4-16-19-10-14(11-20-16)13-7-5-12(6-8-13)9-15(17)18/h3-4,9,12-14,16H,2,5-8,10-11H2,1H3/b4-3+ |
| InChIKey | NCABQRHDKPYSBE-ONEGZZNKSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|