C20H32F2O2 — CID 20599752
2-[(E)-but-1-enyl]-5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-1,3-dioxane (PubChem CID 20599752) has the molecular formula C20H32F2O2 and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-[(E)-but-1-enyl]-5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-1,3-dioxane.
| Compound Name | 2-[(E)-but-1-enyl]-5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599752 |
| Molecular Formula | C20H32F2O2 |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-[(E)-but-1-enyl]-5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]butyl]-1,3-dioxane |
| SMILES | CC/C=C/C1OCC(CCCCC2CCC(C=C(F)F)CC2)CO1 |
| InChI | InChI=1S/C20H32F2O2/c1-2-3-8-20-23-14-18(15-24-20)7-5-4-6-16-9-11-17(12-10-16)13-19(21)22/h3,8,13,16-18,20H,2,4-7,9-12,14-15H2,1H3/b8-3+ |
| InChIKey | BMLMPMLEIXCFBK-FPYGCLRLSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|