C19H28F2O2 — CID 20599917
5-[4-(2,2-difluoroethenyl)cyclohexyl]-2-[(1E,5E)-hepta-1,5-dienyl]-1,3-dioxane (PubChem CID 20599917) has the molecular formula C19H28F2O2 and a molecular weight of 326.43 g/mol. Its IUPAC name is 5-[4-(2,2-difluoroethenyl)cyclohexyl]-2-[(1E,5E)-hepta-1,5-dienyl]-1,3-dioxane.
| Compound Name | 5-[4-(2,2-difluoroethenyl)cyclohexyl]-2-[(1E,5E)-hepta-1,5-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599917 |
| Molecular Formula | C19H28F2O2 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 5-[4-(2,2-difluoroethenyl)cyclohexyl]-2-[(1E,5E)-hepta-1,5-dienyl]-1,3-dioxane |
| SMILES | C/C=C/CC/C=C/C1OCC(C2CCC(C=C(F)F)CC2)CO1 |
| InChI | InChI=1S/C19H28F2O2/c1-2-3-4-5-6-7-19-22-13-17(14-23-19)16-10-8-15(9-11-16)12-18(20)21/h2-3,6-7,12,15-17,19H,4-5,8-11,13-14H2,1H3/b3-2+,7-6+ |
| InChIKey | BDNWJOBFGCRZBT-BLWKUPHCSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|