C16H31NO — CID 20617168
N-[(E)-4,4-dimethylpent-2-enyl]-6,6-dimethylheptanamide (PubChem CID 20617168) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N-[(E)-4,4-dimethylpent-2-enyl]-6,6-dimethylheptanamide.
| Compound Name | N-[(E)-4,4-dimethylpent-2-enyl]-6,6-dimethylheptanamide |
|---|---|
| PubChem CID | 20617168 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-[(E)-4,4-dimethylpent-2-enyl]-6,6-dimethylheptanamide |
| SMILES | CC(C)(C)/C=C/CNC(=O)CCCCC(C)(C)C |
| InChI | InChI=1S/C16H31NO/c1-15(2,3)11-8-7-10-14(18)17-13-9-12-16(4,5)6/h9,12H,7-8,10-11,13H2,1-6H3,(H,17,18)/b12-9+ |
| InChIKey | ZJJXUWCGFYSRAU-FMIVXFBMSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|