C23H34N2O12 — CID 20654760
[2-[(E)-[[1-(2-methylprop-2-enylperoxy)-3-prop-2-enylperoxypropan-2-yl]oxycarbonylamino]methyliminomethyl]peroxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate (PubChem CID 20654760) has the molecular formula C23H34N2O12 and a molecular weight of 530.53 g/mol. Its IUPAC name is [2-[(E)-[[1-(2-methylprop-2-enylperoxy)-3-prop-2-enylperoxypropan-2-yl]oxycarbonylamino]methyliminomethyl]peroxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[(E)-[[1-(2-methylprop-2-enylperoxy)-3-prop-2-enylperoxypropan-2-yl]oxycarbonylamino]methyliminomethyl]peroxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20654760 |
| Molecular Formula | C23H34N2O12 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [2-[(E)-[[1-(2-methylprop-2-enylperoxy)-3-prop-2-enylperoxypropan-2-yl]oxycarbonylamino]methyliminomethyl]peroxy-3-prop-2-enoyloxypropyl] 2-methylprop-2-enoate |
| SMILES | C=CCOOCC(COOCC(=C)C)OC(=O)NC/N=C/OOC(COC(=O)C=C)COC(=O)C(=C)C |
| InChI | InChI=1S/C23H34N2O12/c1-7-9-31-33-13-19(14-34-32-10-17(3)4)36-23(28)25-15-24-16-35-37-20(11-29-21(26)8-2)12-30-22(27)18(5)6/h7-8,16,19-20H,1-3,5,9-15H2,4,6H3,(H,25,28)/b24-16+ |
| InChIKey | CRLZBJSEMYMRED-LFVJCYFKSA-N |
| XLogP | 1.89 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|