C37H29ClN6O7+2 — CID 20775256
[amino-[4-[6'-[4-[[amino(azaniumylidene)methyl]amino]benzoyl]oxy-5-(chloromethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxycarbonylanilino]methylidene]azanium (PubChem CID 20775256) has the molecular formula C37H29ClN6O7+2 and a molecular weight of 705.13 g/mol. Its IUPAC name is [amino-[4-[6'-[4-[[amino(azaniumylidene)methyl]amino]benzoyl]oxy-5-(chloromethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxycarbonylanilino]methylidene]azanium.
| Compound Name | [amino-[4-[6'-[4-[[amino(azaniumylidene)methyl]amino]benzoyl]oxy-5-(chloromethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxycarbonylanilino]methylidene]azanium |
|---|---|
| PubChem CID | 20775256 |
| Molecular Formula | C37H29ClN6O7+2 |
| Molecular Weight | 705.13 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | [amino-[4-[6'-[4-[[amino(azaniumylidene)methyl]amino]benzoyl]oxy-5-(chloromethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxycarbonylanilino]methylidene]azanium |
| SMILES | NC(=[NH2+])Nc1ccc(C(=O)Oc2ccc3c(c2)Oc2cc(OC(=O)c4ccc(NC(N)=[NH2+])cc4)ccc2C32OC(=O)c3cc(CCl)ccc32)cc1 |
| InChI | InChI=1S/C37H27ClN6O7/c38-18-19-1-12-27-26(15-19)34(47)51-37(27)28-13-10-24(48-32(45)20-2-6-22(7-3-20)43-35(39)40)16-30(28)50-31-17-25(11-14-29(31)37)49-33(46)21-4-8-23(9-5-21)44-36(41)42/h1-17H,18H2,(H4,39,40,43)(H4,41,42,44)/p+2 |
| InChIKey | QZQKXDVLCGEFHH-UHFFFAOYSA-P |
| XLogP | 2.40 |
| TPSA | 215.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|