C23H25N5O4 — CID 20977513
3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,5,6,7,8-hexahydroquinoxalin-1-yl]furan-2-carbaldehyde (PubChem CID 20977513) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,5,6,7,8-hexahydroquinoxalin-1-yl]furan-2-carbaldehyde.
| Compound Name | 3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,5,6,7,8-hexahydroquinoxalin-1-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 20977513 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,5,6,7,8-hexahydroquinoxalin-1-yl]furan-2-carbaldehyde |
| SMILES | COc1cc2nc(N3CCN(c4ccoc4C=O)C4=C3CCCC4)nc(N)c2cc1OC |
| InChI | InChI=1S/C23H25N5O4/c1-30-19-11-14-15(12-20(19)31-2)25-23(26-22(14)24)28-9-8-27(16-5-3-4-6-17(16)28)18-7-10-32-21(18)13-29/h7,10-13H,3-6,8-9H2,1-2H3,(H2,24,25,26) |
| InChIKey | BERFGPCBBGLZNP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|