C19H26N4O3S — CID 21440048
[3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-oxido-1-propylimidazolidin-3-ium-4-yl] benzoate (PubChem CID 21440048) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is [3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-oxido-1-propylimidazolidin-3-ium-4-yl] benzoate.
| Compound Name | [3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-oxido-1-propylimidazolidin-3-ium-4-yl] benzoate |
|---|---|
| PubChem CID | 21440048 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-oxido-1-propylimidazolidin-3-ium-4-yl] benzoate |
| SMILES | CCCN1CC(OC(=O)c2ccccc2)[N+]([O-])(c2nnc(C(C)(C)C)s2)C1 |
| InChI | InChI=1S/C19H26N4O3S/c1-5-11-22-12-15(26-16(24)14-9-7-6-8-10-14)23(25,13-22)18-21-20-17(27-18)19(2,3)4/h6-10,15H,5,11-13H2,1-4H3 |
| InChIKey | YQQMOZQYBPROGE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|