C10H13N7O2 — CID 22086588
(1E)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]guanidine (PubChem CID 22086588) has the molecular formula C10H13N7O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is (1E)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]guanidine.
| Compound Name | (1E)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]guanidine |
|---|---|
| PubChem CID | 22086588 |
| Molecular Formula | C10H13N7O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (1E)-1-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]guanidine |
| SMILES | [H]/N=C(N)/N=C/Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H13N7O2/c1-15-7-6(8(18)16(2)10(15)19)17(5-14-7)4-3-13-9(11)12/h3,5H,4H2,1-2H3,(H3,11,12)/b13-3+ |
| InChIKey | NVEKWOXPTNFZPN-QLKAYGNNSA-N |
| XLogP | -1.60 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|