C29H35ClF3N3O2 — CID 22164916
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[benzyl-[6-(1-pyridin-2-ylethoxy)hexyl]amino]ethanol (PubChem CID 22164916) has the molecular formula C29H35ClF3N3O2 and a molecular weight of 550.07 g/mol. Its IUPAC name is 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[benzyl-[6-(1-pyridin-2-ylethoxy)hexyl]amino]ethanol.
| Compound Name | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[benzyl-[6-(1-pyridin-2-ylethoxy)hexyl]amino]ethanol |
|---|---|
| PubChem CID | 22164916 |
| Molecular Formula | C29H35ClF3N3O2 |
| Molecular Weight | 550.07 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[benzyl-[6-(1-pyridin-2-ylethoxy)hexyl]amino]ethanol |
| SMILES | CC(OCCCCCCN(Cc1ccccc1)CC(O)c1cc(Cl)c(N)c(C(F)(F)F)c1)c1ccccn1 |
| InChI | InChI=1S/C29H35ClF3N3O2/c1-21(26-13-7-8-14-35-26)38-16-10-3-2-9-15-36(19-22-11-5-4-6-12-22)20-27(37)23-17-24(29(31,32)33)28(34)25(30)18-23/h4-8,11-14,17-18,21,27,37H,2-3,9-10,15-16,19-20,34H2,1H3 |
| InChIKey | JQLPAOHBRAIFNZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.07 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|