C26H35N3O2SSi — CID 22242824
tert-butyl-diphenyl-[1-(1,3-thiazol-2-yl)azetidin-3-yl]oxysilane;N-propan-2-ylformamide (PubChem CID 22242824) has the molecular formula C26H35N3O2SSi and a molecular weight of 481.74 g/mol. Its IUPAC name is tert-butyl-diphenyl-[1-(1,3-thiazol-2-yl)azetidin-3-yl]oxysilane;N-propan-2-ylformamide.
| Compound Name | tert-butyl-diphenyl-[1-(1,3-thiazol-2-yl)azetidin-3-yl]oxysilane;N-propan-2-ylformamide |
|---|---|
| PubChem CID | 22242824 |
| Molecular Formula | C26H35N3O2SSi |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | tert-butyl-diphenyl-[1-(1,3-thiazol-2-yl)azetidin-3-yl]oxysilane;N-propan-2-ylformamide |
| SMILES | CC(C)(C)[Si](OC1CN(c2nccs2)C1)(c1ccccc1)c1ccccc1.CC(C)NC=O |
| InChI | InChI=1S/C22H26N2OSSi.C4H9NO/c1-22(2,3)27(19-10-6-4-7-11-19,20-12-8-5-9-13-20)25-18-16-24(17-18)21-23-14-15-26-21;1-4(2)5-3-6/h4-15,18H,16-17H2,1-3H3;3-4H,1-2H3,(H,5,6) |
| InChIKey | VNTFVWDUELUMAO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|