C31H31F3N4O5 — CID 22563054
4-[3-[6-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22563054) has the molecular formula C31H31F3N4O5 and a molecular weight of 596.61 g/mol. Its IUPAC name is 4-[3-[6-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[6-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22563054 |
| Molecular Formula | C31H31F3N4O5 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 4-[3-[6-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCCCCCN2CCN(C(=O)c3ccc4c(c3)OCO4)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C31H31F3N4O5/c1-20-24(30(41)38(28(20)39)23-9-7-22(18-35)25(17-23)31(32,33)34)6-4-2-3-5-11-36-12-14-37(15-13-36)29(40)21-8-10-26-27(16-21)43-19-42-26/h7-10,16-17H,2-6,11-15,19H2,1H3 |
| InChIKey | ASKMRLGPUMLCRJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 103.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|