C34H33F3N4O3 — CID 22562410
4-[3-methyl-4-[6-[4-(naphthalene-2-carbonyl)piperazin-1-yl]hexyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562410) has the molecular formula C34H33F3N4O3 and a molecular weight of 602.66 g/mol. Its IUPAC name is 4-[3-methyl-4-[6-[4-(naphthalene-2-carbonyl)piperazin-1-yl]hexyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-methyl-4-[6-[4-(naphthalene-2-carbonyl)piperazin-1-yl]hexyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562410 |
| Molecular Formula | C34H33F3N4O3 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 4-[3-methyl-4-[6-[4-(naphthalene-2-carbonyl)piperazin-1-yl]hexyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCCCCCN2CCN(C(=O)c3ccc4ccccc4c3)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C34H33F3N4O3/c1-23-29(33(44)41(31(23)42)28-14-13-27(22-38)30(21-28)34(35,36)37)10-4-2-3-7-15-39-16-18-40(19-17-39)32(43)26-12-11-24-8-5-6-9-25(24)20-26/h5-6,8-9,11-14,20-21H,2-4,7,10,15-19H2,1H3 |
| InChIKey | NJBCDISZCXOQSR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|