C33H38F3N5O3 — CID 22562420
4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide (PubChem CID 22562420) has the molecular formula C33H38F3N5O3 and a molecular weight of 609.69 g/mol. Its IUPAC name is 4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22562420 |
| Molecular Formula | C33H38F3N5O3 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | 4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(4-propan-2-ylphenyl)piperazine-1-carboxamide |
| SMILES | CC1=C(CCCCCCN2CCN(C(=O)Nc3ccc(C(C)C)cc3)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C33H38F3N5O3/c1-22(2)24-9-12-26(13-10-24)38-32(44)40-18-16-39(17-19-40)15-7-5-4-6-8-28-23(3)30(42)41(31(28)43)27-14-11-25(21-37)29(20-27)33(34,35)36/h9-14,20,22H,4-8,15-19H2,1-3H3,(H,38,44) |
| InChIKey | XHZMPUGCFBJZNC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|