C27H33F3N4O3S — CID 91292812
O-methyl 4-[8-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]octyl]piperazine-1-carbothioate (PubChem CID 91292812) has the molecular formula C27H33F3N4O3S and a molecular weight of 550.65 g/mol. Its IUPAC name is O-methyl 4-[8-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]octyl]piperazine-1-carbothioate.
| Compound Name | O-methyl 4-[8-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]octyl]piperazine-1-carbothioate |
|---|---|
| PubChem CID | 91292812 |
| Molecular Formula | C27H33F3N4O3S |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | O-methyl 4-[8-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]octyl]piperazine-1-carbothioate |
| SMILES | COC(=S)N1CCN(CCCCCCCCC2=C(C)C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C2=O)CC1 |
| InChI | InChI=1S/C27H33F3N4O3S/c1-19-22(9-7-5-3-4-6-8-12-32-13-15-33(16-14-32)26(38)37-2)25(36)34(24(19)35)21-11-10-20(18-31)23(17-21)27(28,29)30/h10-11,17H,3-9,12-16H2,1-2H3 |
| InChIKey | AKOOKMBNNOTEJI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|