C30H29F3N6O3 — CID 22562363
N-(3-cyanophenyl)-4-[5-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]pentyl]piperazine-1-carboxamide (PubChem CID 22562363) has the molecular formula C30H29F3N6O3 and a molecular weight of 578.60 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-[5-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]pentyl]piperazine-1-carboxamide.
| Compound Name | N-(3-cyanophenyl)-4-[5-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]pentyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22562363 |
| Molecular Formula | C30H29F3N6O3 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | N-(3-cyanophenyl)-4-[5-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]pentyl]piperazine-1-carboxamide |
| SMILES | CC1=C(CCCCCN2CCN(C(=O)Nc3cccc(C#N)c3)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C30H29F3N6O3/c1-20-25(28(41)39(27(20)40)24-10-9-22(19-35)26(17-24)30(31,32)33)8-3-2-4-11-37-12-14-38(15-13-37)29(42)36-23-7-5-6-21(16-23)18-34/h5-7,9-10,16-17H,2-4,8,11-15H2,1H3,(H,36,42) |
| InChIKey | CAFAWLRHDZDEQX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|