C30H30F3N5O4S — CID 22562898
4-[3-[6-[4-(3-cyanophenyl)sulfonylpiperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562898) has the molecular formula C30H30F3N5O4S and a molecular weight of 613.66 g/mol. Its IUPAC name is 4-[3-[6-[4-(3-cyanophenyl)sulfonylpiperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[6-[4-(3-cyanophenyl)sulfonylpiperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562898 |
| Molecular Formula | C30H30F3N5O4S |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | 4-[3-[6-[4-(3-cyanophenyl)sulfonylpiperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCCCCCN2CCN(S(=O)(=O)c3cccc(C#N)c3)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C30H30F3N5O4S/c1-21-26(29(40)38(28(21)39)24-11-10-23(20-35)27(18-24)30(31,32)33)9-4-2-3-5-12-36-13-15-37(16-14-36)43(41,42)25-8-6-7-22(17-25)19-34/h6-8,10-11,17-18H,2-5,9,12-16H2,1H3 |
| InChIKey | MGRBFWPVIUWNAM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 125.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|