C26H25F3N4O4S — CID 10289631
4-[3-[2-(4-benzylsulfonylpiperazin-1-yl)ethyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 10289631) has the molecular formula C26H25F3N4O4S and a molecular weight of 546.57 g/mol. Its IUPAC name is 4-[3-[2-(4-benzylsulfonylpiperazin-1-yl)ethyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[2-(4-benzylsulfonylpiperazin-1-yl)ethyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 10289631 |
| Molecular Formula | C26H25F3N4O4S |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 4-[3-[2-(4-benzylsulfonylpiperazin-1-yl)ethyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCN2CCN(S(=O)(=O)Cc3ccccc3)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C26H25F3N4O4S/c1-18-22(25(35)33(24(18)34)21-8-7-20(16-30)23(15-21)26(27,28)29)9-10-31-11-13-32(14-12-31)38(36,37)17-19-5-3-2-4-6-19/h2-8,15H,9-14,17H2,1H3 |
| InChIKey | KWGUDRAQEJVJLN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|