C30H30ClF3N4O3 — CID 10239996
4-[3-[6-[4-(4-chlorobenzoyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 10239996) has the molecular formula C30H30ClF3N4O3 and a molecular weight of 587.04 g/mol. Its IUPAC name is 4-[3-[6-[4-(4-chlorobenzoyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[6-[4-(4-chlorobenzoyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 10239996 |
| Molecular Formula | C30H30ClF3N4O3 |
| Molecular Weight | 587.04 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 4-[3-[6-[4-(4-chlorobenzoyl)piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCCCCCN2CCN(C(=O)c3ccc(Cl)cc3)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C30H30ClF3N4O3/c1-20-25(29(41)38(27(20)39)24-12-9-22(19-35)26(18-24)30(32,33)34)6-4-2-3-5-13-36-14-16-37(17-15-36)28(40)21-7-10-23(31)11-8-21/h7-12,18H,2-6,13-17H2,1H3 |
| InChIKey | VDHNDOUFPFZEPD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.04 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|