C28H25F5N4O3 — CID 22562895
4-[3-[4-[4-(2,6-difluorobenzoyl)piperazin-1-yl]butyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562895) has the molecular formula C28H25F5N4O3 and a molecular weight of 560.52 g/mol. Its IUPAC name is 4-[3-[4-[4-(2,6-difluorobenzoyl)piperazin-1-yl]butyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-[4-(2,6-difluorobenzoyl)piperazin-1-yl]butyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562895 |
| Molecular Formula | C28H25F5N4O3 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 4-[3-[4-[4-(2,6-difluorobenzoyl)piperazin-1-yl]butyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCCCN2CCN(C(=O)c3c(F)cccc3F)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C28H25F5N4O3/c1-17-20(26(39)37(25(17)38)19-9-8-18(16-34)21(15-19)28(31,32)33)5-2-3-10-35-11-13-36(14-12-35)27(40)24-22(29)6-4-7-23(24)30/h4,6-9,15H,2-3,5,10-14H2,1H3 |
| InChIKey | NXRZAUZUJCQMSZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|