C27H33F3N4O3 — CID 22562821
4-[3-methyl-4-[5-[4-(3-methylbutanoyl)piperazin-1-yl]pentyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562821) has the molecular formula C27H33F3N4O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is 4-[3-methyl-4-[5-[4-(3-methylbutanoyl)piperazin-1-yl]pentyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-methyl-4-[5-[4-(3-methylbutanoyl)piperazin-1-yl]pentyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562821 |
| Molecular Formula | C27H33F3N4O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 4-[3-methyl-4-[5-[4-(3-methylbutanoyl)piperazin-1-yl]pentyl]-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCCCCN2CCN(C(=O)CC(C)C)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C27H33F3N4O3/c1-18(2)15-24(35)33-13-11-32(12-14-33)10-6-4-5-7-22-19(3)25(36)34(26(22)37)21-9-8-20(17-31)23(16-21)27(28,29)30/h8-9,16,18H,4-7,10-15H2,1-3H3 |
| InChIKey | IAGLPDKQZDIDBD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|