C29H28ClF3N4O3 — CID 22563163
4-[3-[5-[4-(2-chlorobenzoyl)piperazin-1-yl]pentyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22563163) has the molecular formula C29H28ClF3N4O3 and a molecular weight of 573.02 g/mol. Its IUPAC name is 4-[3-[5-[4-(2-chlorobenzoyl)piperazin-1-yl]pentyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[5-[4-(2-chlorobenzoyl)piperazin-1-yl]pentyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22563163 |
| Molecular Formula | C29H28ClF3N4O3 |
| Molecular Weight | 573.02 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 4-[3-[5-[4-(2-chlorobenzoyl)piperazin-1-yl]pentyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=C(CCCCCN2CCN(C(=O)c3ccccc3Cl)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C29H28ClF3N4O3/c1-19-22(28(40)37(26(19)38)21-11-10-20(18-34)24(17-21)29(31,32)33)7-3-2-6-12-35-13-15-36(16-14-35)27(39)23-8-4-5-9-25(23)30/h4-5,8-11,17H,2-3,6-7,12-16H2,1H3 |
| InChIKey | FRYREYAORZBFSJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|