C28H37F3N4O6S — CID 10153320
4-[3-[6-[4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 10153320) has the molecular formula C28H37F3N4O6S and a molecular weight of 614.69 g/mol. Its IUPAC name is 4-[3-[6-[4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[6-[4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 10153320 |
| Molecular Formula | C28H37F3N4O6S |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | 4-[3-[6-[4-[2-(2-methoxyethoxy)ethylsulfonyl]piperazin-1-yl]hexyl]-4-methyl-2,5-dioxopyrrol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COCCOCCS(=O)(=O)N1CCN(CCCCCCC2=C(C)C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C2=O)CC1 |
| InChI | InChI=1S/C28H37F3N4O6S/c1-21-24(27(37)35(26(21)36)23-9-8-22(20-32)25(19-23)28(29,30)31)7-5-3-4-6-10-33-11-13-34(14-12-33)42(38,39)18-17-41-16-15-40-2/h8-9,19H,3-7,10-18H2,1-2H3 |
| InChIKey | DSYUSKFYRHVNOF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 120.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|