C17H21N7 — CID 23172417
2-piperazin-1-yl-4,6-bis(2H-pyridin-1-yl)-1,3,5-triazine (PubChem CID 23172417) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-piperazin-1-yl-4,6-bis(2H-pyridin-1-yl)-1,3,5-triazine.
| Compound Name | 2-piperazin-1-yl-4,6-bis(2H-pyridin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 23172417 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-piperazin-1-yl-4,6-bis(2H-pyridin-1-yl)-1,3,5-triazine |
| SMILES | C1=CCN(c2nc(N3C=CC=CC3)nc(N3CCNCC3)n2)C=C1 |
| InChI | InChI=1S/C17H21N7/c1-3-9-22(10-4-1)15-19-16(23-11-5-2-6-12-23)21-17(20-15)24-13-7-18-8-14-24/h1-6,9,11,18H,7-8,10,12-14H2 |
| InChIKey | KDHDEUIUEUFRPF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |