C8H5F8O2- — CID 23174814
4,4,5,5,6,6,7,7-octafluoro-2-methylideneheptanoate (PubChem CID 23174814) has the molecular formula C8H5F8O2- and a molecular weight of 285.11 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-2-methylideneheptanoate.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-2-methylideneheptanoate |
|---|---|
| PubChem CID | 23174814 |
| Molecular Formula | C8H5F8O2- |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-2-methylideneheptanoate |
| SMILES | C=C(CC(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)[O-] |
| InChI | InChI=1S/C8H6F8O2/c1-3(4(17)18)2-6(11,12)8(15,16)7(13,14)5(9)10/h5H,1-2H2,(H,17,18)/p-1 |
| InChIKey | YLGFQEYDJHFHEB-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|