C36H63N7O6 — CID 23344714
3-[3-[cyclohexyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 23344714) has the molecular formula C36H63N7O6 and a molecular weight of 689.94 g/mol. Its IUPAC name is 3-[3-[cyclohexyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[3-[cyclohexyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 23344714 |
| Molecular Formula | C36H63N7O6 |
| Molecular Weight | 689.94 g/mol |
| Exact Mass | 689.48 |
| IUPAC Name | 3-[3-[cyclohexyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)NC(=O)N(CC(O)CN(CC(O)CN1C(=O)NC3(CC(C)(C)N(C)C(C)(C)C3)C1=O)C1CCCCC1)C2=O |
| InChI | InChI=1S/C36H63N7O6/c1-31(2)20-35(21-32(3,4)39(31)9)27(46)42(29(48)37-35)18-25(44)16-41(24-14-12-11-13-15-24)17-26(45)19-43-28(47)36(38-30(43)49)22-33(5,6)40(10)34(7,8)23-36/h24-26,44-45H,11-23H2,1-10H3,(H,37,48)(H,38,49) |
| InChIKey | TVFVCXUSLNHWES-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.94 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|