C29H31ClO8S — CID 23517227
[(2S,3R,4S)-4-[3-(hydroxymethyl)oxiren-2-yl]-1,3,4-tris(phenylmethoxy)butan-2-yl] chloromethanesulfonate (PubChem CID 23517227) has the molecular formula C29H31ClO8S and a molecular weight of 575.08 g/mol. Its IUPAC name is [(2S,3R,4S)-4-[3-(hydroxymethyl)oxiren-2-yl]-1,3,4-tris(phenylmethoxy)butan-2-yl] chloromethanesulfonate.
| Compound Name | [(2S,3R,4S)-4-[3-(hydroxymethyl)oxiren-2-yl]-1,3,4-tris(phenylmethoxy)butan-2-yl] chloromethanesulfonate |
|---|---|
| PubChem CID | 23517227 |
| Molecular Formula | C29H31ClO8S |
| Molecular Weight | 575.08 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | [(2S,3R,4S)-4-[3-(hydroxymethyl)oxiren-2-yl]-1,3,4-tris(phenylmethoxy)butan-2-yl] chloromethanesulfonate |
| SMILES | O=S(=O)(CCl)O[C@@H](COCc1ccccc1)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)C1=C(CO)O1 |
| InChI | InChI=1S/C29H31ClO8S/c30-21-39(32,33)38-26(20-34-17-22-10-4-1-5-11-22)27(35-18-23-12-6-2-7-13-23)29(28-25(16-31)37-28)36-19-24-14-8-3-9-15-24/h1-15,26-27,29,31H,16-21H2/t26-,27-,29-/m0/s1 |
| InChIKey | XYYMVIGSPVGEFC-YCVJPRETSA-N |
| XLogP | 4.52 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.08 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|