C10H12N2 — CID 23517729
N'-ethyl-N'-phenylethyne-1,2-diamine (PubChem CID 23517729) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is N'-ethyl-N'-phenylethyne-1,2-diamine.
| Compound Name | N'-ethyl-N'-phenylethyne-1,2-diamine |
|---|---|
| PubChem CID | 23517729 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N'-ethyl-N'-phenylethyne-1,2-diamine |
| SMILES | CCN(C#CN)c1ccccc1 |
| InChI | InChI=1S/C10H12N2/c1-2-12(9-8-11)10-6-4-3-5-7-10/h3-7H,2,11H2,1H3 |
| InChIKey | BUONYNGLFIVQKA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|