C26H28O6 — CID 23642765
[(R)-[(3aR,5S,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-phenylmethyl] (E)-3-phenylprop-2-enoate (PubChem CID 23642765) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is [(R)-[(3aR,5S,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-phenylmethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(R)-[(3aR,5S,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-phenylmethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 23642765 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | [(R)-[(3aR,5S,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-phenylmethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)O[C@H](c1ccccc1)[C@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C26H28O6/c27-20(15-14-18-10-4-1-5-11-18)29-22(19-12-6-2-7-13-19)23-21(28)24-25(30-23)32-26(31-24)16-8-3-9-17-26/h1-2,4-7,10-15,21-25,28H,3,8-9,16-17H2/b15-14+/t21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | PZVIXBULTHKNKO-BWOPSUKQSA-N |
| XLogP | 4.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|