C12H13Br2NO4 — CID 23749497
(E,4S,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide (PubChem CID 23749497) has the molecular formula C12H13Br2NO4 and a molecular weight of 395.05 g/mol. Its IUPAC name is (E,4S,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide.
| Compound Name | (E,4S,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 23749497 |
| Molecular Formula | C12H13Br2NO4 |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | (E,4S,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide |
| SMILES | C[C@@H](/C=C/C(=O)NO)[C@@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C12H13Br2NO4/c1-6(2-3-10(16)15-19)11(17)8-4-7(13)5-9(14)12(8)18/h2-6,11,17-19H,1H3,(H,15,16)/b3-2+/t6-,11+/m0/s1 |
| InChIKey | HETROSPRKBQLRH-JMDDRZBMSA-N |
| XLogP | 2.65 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|