C32H39N3O4 — CID 24983546
N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-hydroxy-4-[2-(2-methylphenoxy)phenyl]butyl]acetamide (PubChem CID 24983546) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-hydroxy-4-[2-(2-methylphenoxy)phenyl]butyl]acetamide.
| Compound Name | N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-hydroxy-4-[2-(2-methylphenoxy)phenyl]butyl]acetamide |
|---|---|
| PubChem CID | 24983546 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-hydroxy-4-[2-(2-methylphenoxy)phenyl]butyl]acetamide |
| SMILES | CC(=O)NCCCC(O)(c1ccccc1Oc1ccccc1C)C1CCCN(C(=O)c2ccc(CN)cc2)C1 |
| InChI | InChI=1S/C32H39N3O4/c1-23-9-3-5-12-29(23)39-30-13-6-4-11-28(30)32(38,18-8-19-34-24(2)36)27-10-7-20-35(22-27)31(37)26-16-14-25(21-33)15-17-26/h3-6,9,11-17,27,38H,7-8,10,18-22,33H2,1-2H3,(H,34,36) |
| InChIKey | FISZNVIODXDDDN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|