C16H16N4O9 — CID 2752189
7-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-8-ol;2,4,6-trinitrophenolate (PubChem CID 2752189) has the molecular formula C16H16N4O9 and a molecular weight of 408.32 g/mol. Its IUPAC name is 7-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-8-ol;2,4,6-trinitrophenolate.
| Compound Name | 7-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-8-ol;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 2752189 |
| Molecular Formula | C16H16N4O9 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 7-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-8-ol;2,4,6-trinitrophenolate |
| SMILES | COc1ccc2c(c1O)C[NH2+]CC2.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13NO2.C6H3N3O7/c1-13-9-3-2-7-4-5-11-6-8(7)10(9)12;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h2-3,11-12H,4-6H2,1H3;1-2,10H |
| InChIKey | CWYOREGFHVWTHR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 198.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|