C4H3Br2NO2S2 — CID 2805145
4,5-dibromothiophene-2-sulfonamide (PubChem CID 2805145) has the molecular formula C4H3Br2NO2S2 and a molecular weight of 321.02 g/mol. Its IUPAC name is 4,5-dibromothiophene-2-sulfonamide.
| Compound Name | 4,5-dibromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2805145 |
| Molecular Formula | C4H3Br2NO2S2 |
| Molecular Weight | 321.02 g/mol |
| Exact Mass | 318.80 |
| IUPAC Name | 4,5-dibromothiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C4H3Br2NO2S2/c5-2-1-3(10-4(2)6)11(7,8)9/h1H,(H2,7,8,9) |
| InChIKey | XBUBKAHZGMXJBC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.02 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |