C8H2Br4CaO6S4 — CID 87784725
calcium bis(4,5-dibromothiophene-2-sulfonate) (PubChem CID 87784725) has the molecular formula C8H2Br4CaO6S4 and a molecular weight of 682.06 g/mol. Its IUPAC name is calcium bis(4,5-dibromothiophene-2-sulfonate).
| Compound Name | calcium bis(4,5-dibromothiophene-2-sulfonate) |
|---|---|
| PubChem CID | 87784725 |
| Molecular Formula | C8H2Br4CaO6S4 |
| Molecular Weight | 682.06 g/mol |
| Exact Mass | 677.51 |
| IUPAC Name | calcium bis(4,5-dibromothiophene-2-sulfonate) |
| SMILES | O=S(=O)([O-])c1cc(Br)c(Br)s1.O=S(=O)([O-])c1cc(Br)c(Br)s1.[Ca+2] |
| InChI | InChI=1S/2C4H2Br2O3S2.Ca/c2*5-2-1-3(10-4(2)6)11(7,8)9;/h2*1H,(H,7,8,9);/q;;+2/p-2 |
| InChIKey | HJJPZQVNZORDJP-UHFFFAOYSA-L |
| XLogP | 3.97 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.06 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|