C21H25N3O4 — CID 3101537
N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-3,4,5-trimethoxybenzohydrazide (PubChem CID 3101537) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 3101537 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC2=NC(C)(C)Cc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O4/c1-21(2)12-13-8-6-7-9-15(13)19(22-21)23-24-20(25)14-10-16(26-3)18(28-5)17(11-14)27-4/h6-11H,12H2,1-5H3,(H,22,23)(H,24,25) |
| InChIKey | RMTTWWCANKQJCA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|